About N-cyclohexyl-N-(oxetan-3-ylmethyl)aniline;2-methyl-1H-indole-3-carboxamide
N-cyclohexyl-N-(oxetan-3-ylmethyl)aniline;2-methyl-1H-indole-3-carboxamide (PubChem CID 164539872) has the molecular formula C26H33N3O2
and a molecular weight of 419.57 g/mol. Its IUPAC name is N-cyclohexyl-N-(oxetan-3-ylmethyl)aniline;2-methyl-1H-indole-3-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-N-(oxetan-3-ylmethyl)aniline;2-methyl-1H-indole-3-carboxamide |
| PubChem CID | 164539872 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | N-cyclohexyl-N-(oxetan-3-ylmethyl)aniline;2-methyl-1H-indole-3-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1C(N)=O.c1ccc(N(CC2COC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C16H23NO.C10H10N2O/c1-3-7-15(8-4-1)17(11-14-12-18-13-14)16-9-5-2-6-10-16;1-6-9(10(11)13)7-4-2-3-5-8(7)12-6/h1,3-4,7-8,14,16H,2,5-6,9-13H2;2-5,12H,1H3,(H2,11,13) |
| InChIKey | UZCUXQQJXLLNNX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexyl-N-(oxetan-3-ylmethyl)aniline;2-methyl-1H-indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N-(oxetan-3-ylmethyl)aniline;2-methyl-1H-indole-3-carboxamide?
The IUPAC name of N-cyclohexyl-N-(oxetan-3-ylmethyl)aniline;2-methyl-1H-indole-3-carboxamide (CID 164539872) is N-cyclohexyl-N-(oxetan-3-ylmethyl)aniline;2-methyl-1H-indole-3-carboxamide.
What is the SMILES notation for N-cyclohexyl-N-(oxetan-3-ylmethyl)aniline;2-methyl-1H-indole-3-carboxamide?
The canonical SMILES for N-cyclohexyl-N-(oxetan-3-ylmethyl)aniline;2-methyl-1H-indole-3-carboxamide is Cc1[nH]c2ccccc2c1C(N)=O.c1ccc(N(CC2COC2)C2CCCCC2)cc1.
What is the InChIKey of N-cyclohexyl-N-(oxetan-3-ylmethyl)aniline;2-methyl-1H-indole-3-carboxamide?
The InChIKey is UZCUXQQJXLLNNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO.C10H10N2O/c1-3-7-15(8-4-1)17(11-14-12-18-13-14)16-9-5-2-6-10-16;1-6-9(10(11)13)7-4-2-3-5-8(7)12-6/h1,3-4,7-8,14,16H,2,5-6,9-13H2;2-5,12H,1H3,(H2,11,13).
What are the key properties of N-cyclohexyl-N-(oxetan-3-ylmethyl)aniline;2-methyl-1H-indole-3-carboxamide?
N-cyclohexyl-N-(oxetan-3-ylmethyl)aniline;2-methyl-1H-indole-3-carboxamide has a molecular weight of 419.57 g/mol, XLogP of 5.05, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N-(oxetan-3-ylmethyl)aniline;2-methyl-1H-indole-3-carboxamide is sourced from PubChem (CID 164539872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).