C22H20ClF3N4 — CID 164540030
N-(4-chloro-1H-indol-6-yl)-6-[4-(trifluoromethyl)cyclohexyl]-1H-benzimidazol-2-amine (PubChem CID 164540030) has the molecular formula C22H20ClF3N4 and a molecular weight of 432.88 g/mol. Its IUPAC name is N-(4-chloro-1H-indol-6-yl)-6-[4-(trifluoromethyl)cyclohexyl]-1H-benzimidazol-2-amine.
| Compound Name | N-(4-chloro-1H-indol-6-yl)-6-[4-(trifluoromethyl)cyclohexyl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 164540030 |
| Molecular Formula | C22H20ClF3N4 |
| Molecular Weight | 432.88 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-(4-chloro-1H-indol-6-yl)-6-[4-(trifluoromethyl)cyclohexyl]-1H-benzimidazol-2-amine |
| SMILES | FC(F)(F)C1CCC(c2ccc3nc(Nc4cc(Cl)c5cc[nH]c5c4)[nH]c3c2)CC1 |
| InChI | InChI=1S/C22H20ClF3N4/c23-17-10-15(11-19-16(17)7-8-27-19)28-21-29-18-6-3-13(9-20(18)30-21)12-1-4-14(5-2-12)22(24,25)26/h3,6-12,14,27H,1-2,4-5H2,(H2,28,29,30) |
| InChIKey | AYLLNWVYSNUUEX-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.88 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |