About 4,4-dimethyl-1,2,5-oxadiazine;ethane
4,4-dimethyl-1,2,5-oxadiazine;ethane (PubChem CID 164540095) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is 4,4-dimethyl-1,2,5-oxadiazine;ethane.
Molecular Properties
| Compound Name | 4,4-dimethyl-1,2,5-oxadiazine;ethane |
| PubChem CID | 164540095 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 4,4-dimethyl-1,2,5-oxadiazine;ethane |
| SMILES | CC.CC.CC1(C)C=NOC=N1 |
| InChI | InChI=1S/C5H8N2O.2C2H6/c1-5(2)3-7-8-4-6-5;2*1-2/h3-4H,1-2H3;2*1-2H3 |
| InChIKey | CCUMZGOORKNLLZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,4-dimethyl-1,2,5-oxadiazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-1,2,5-oxadiazine;ethane?
The IUPAC name of 4,4-dimethyl-1,2,5-oxadiazine;ethane (CID 164540095) is 4,4-dimethyl-1,2,5-oxadiazine;ethane.
What is the SMILES notation for 4,4-dimethyl-1,2,5-oxadiazine;ethane?
The canonical SMILES for 4,4-dimethyl-1,2,5-oxadiazine;ethane is CC.CC.CC1(C)C=NOC=N1.
What is the InChIKey of 4,4-dimethyl-1,2,5-oxadiazine;ethane?
The InChIKey is CCUMZGOORKNLLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O.2C2H6/c1-5(2)3-7-8-4-6-5;2*1-2/h3-4H,1-2H3;2*1-2H3.
What are the key properties of 4,4-dimethyl-1,2,5-oxadiazine;ethane?
4,4-dimethyl-1,2,5-oxadiazine;ethane has a molecular weight of 172.27 g/mol, XLogP of 2.86, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-1,2,5-oxadiazine;ethane is sourced from PubChem (CID 164540095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).