C16H28N2O5 — CID 164540235
ethane;[5-[methylcarbamoyl-[(Z)-3-oxoprop-1-enyl]amino]oxolan-2-yl]methyl 2-methylpropanoate (PubChem CID 164540235) has the molecular formula C16H28N2O5 and a molecular weight of 328.41 g/mol. Its IUPAC name is ethane;[5-[methylcarbamoyl-[(Z)-3-oxoprop-1-enyl]amino]oxolan-2-yl]methyl 2-methylpropanoate.
| Compound Name | ethane;[5-[methylcarbamoyl-[(Z)-3-oxoprop-1-enyl]amino]oxolan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 164540235 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | ethane;[5-[methylcarbamoyl-[(Z)-3-oxoprop-1-enyl]amino]oxolan-2-yl]methyl 2-methylpropanoate |
| SMILES | CC.CNC(=O)N(/C=C\C=O)C1CCC(COC(=O)C(C)C)O1 |
| InChI | InChI=1S/C14H22N2O5.C2H6/c1-10(2)13(18)20-9-11-5-6-12(21-11)16(7-4-8-17)14(19)15-3;1-2/h4,7-8,10-12H,5-6,9H2,1-3H3,(H,15,19);1-2H3/b7-4-; |
| InChIKey | VMXRSSVMUYPIGU-ZULQGGHCSA-N |
| XLogP | 2.07 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|