C18H28BrLiN4O3S — CID 164540384
CID 164540384 (PubChem CID 164540384) has the molecular formula C18H28BrLiN4O3S and a molecular weight of 467.36 g/mol.
| Compound Name | CID 164540384 |
|---|---|
| PubChem CID | 164540384 |
| Molecular Formula | C18H28BrLiN4O3S |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | — |
| SMILES | Cc1nc(N2CCC3(CC2)CO[CH-][C@H]3N[S@](=O)C(C)(C)C)c(CO)nc1Br.[Li+] |
| InChI | InChI=1S/C18H28BrN4O3S.Li/c1-12-15(19)21-13(9-24)16(20-12)23-7-5-18(6-8-23)11-26-10-14(18)22-27(25)17(2,3)4;/h10,14,22,24H,5-9,11H2,1-4H3;/q-1;+1/t14-,27-;/m1./s1 |
| InChIKey | GXASTUNSLFSPRV-LONDCNLASA-N |
| XLogP | -0.76 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|