About 3-amino-1H-pyrazolo[1,5-a]pyrimidine-7-thione
3-amino-1H-pyrazolo[1,5-a]pyrimidine-7-thione (PubChem CID 164541034) has the molecular formula C6H6N4S
and a molecular weight of 166.21 g/mol. Its IUPAC name is 3-amino-1H-pyrazolo[1,5-a]pyrimidine-7-thione.
Molecular Properties
| Compound Name | 3-amino-1H-pyrazolo[1,5-a]pyrimidine-7-thione |
| PubChem CID | 164541034 |
| Molecular Formula | C6H6N4S |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 3-amino-1H-pyrazolo[1,5-a]pyrimidine-7-thione |
| SMILES | Nc1c[nH]n2c(=S)ccnc12 |
| InChI | InChI=1S/C6H6N4S/c7-4-3-9-10-5(11)1-2-8-6(4)10/h1-3,9H,7H2 |
| InChIKey | VKRHNSAPYIOFNH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1H-pyrazolo[1,5-a]pyrimidine-7-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1H-pyrazolo[1,5-a]pyrimidine-7-thione?
The IUPAC name of 3-amino-1H-pyrazolo[1,5-a]pyrimidine-7-thione (CID 164541034) is 3-amino-1H-pyrazolo[1,5-a]pyrimidine-7-thione.
What is the SMILES notation for 3-amino-1H-pyrazolo[1,5-a]pyrimidine-7-thione?
The canonical SMILES for 3-amino-1H-pyrazolo[1,5-a]pyrimidine-7-thione is Nc1c[nH]n2c(=S)ccnc12.
What is the InChIKey of 3-amino-1H-pyrazolo[1,5-a]pyrimidine-7-thione?
The InChIKey is VKRHNSAPYIOFNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4S/c7-4-3-9-10-5(11)1-2-8-6(4)10/h1-3,9H,7H2.
What are the key properties of 3-amino-1H-pyrazolo[1,5-a]pyrimidine-7-thione?
3-amino-1H-pyrazolo[1,5-a]pyrimidine-7-thione has a molecular weight of 166.21 g/mol, XLogP of 0.97, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1H-pyrazolo[1,5-a]pyrimidine-7-thione is sourced from PubChem (CID 164541034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).