About ethyl formate;5-(4-ethylsulfanylphenyl)-3-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one
ethyl formate;5-(4-ethylsulfanylphenyl)-3-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 164541054) has the molecular formula C18H21N3O3S
and a molecular weight of 359.45 g/mol. Its IUPAC name is ethyl formate;5-(4-ethylsulfanylphenyl)-3-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | ethyl formate;5-(4-ethylsulfanylphenyl)-3-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 164541054 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | ethyl formate;5-(4-ethylsulfanylphenyl)-3-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCOC=O.CCSc1ccc(-c2cc(=O)n3[nH]cc(C)c3n2)cc1 |
| InChI | InChI=1S/C15H15N3OS.C3H6O2/c1-3-20-12-6-4-11(5-7-12)13-8-14(19)18-15(17-13)10(2)9-16-18;1-2-5-3-4/h4-9,16H,3H2,1-2H3;3H,2H2,1H3 |
| InChIKey | COXQTKDJCNKOIV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl formate;5-(4-ethylsulfanylphenyl)-3-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl formate;5-(4-ethylsulfanylphenyl)-3-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of ethyl formate;5-(4-ethylsulfanylphenyl)-3-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 164541054) is ethyl formate;5-(4-ethylsulfanylphenyl)-3-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for ethyl formate;5-(4-ethylsulfanylphenyl)-3-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for ethyl formate;5-(4-ethylsulfanylphenyl)-3-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one is CCOC=O.CCSc1ccc(-c2cc(=O)n3[nH]cc(C)c3n2)cc1.
What is the InChIKey of ethyl formate;5-(4-ethylsulfanylphenyl)-3-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is COXQTKDJCNKOIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3OS.C3H6O2/c1-3-20-12-6-4-11(5-7-12)13-8-14(19)18-15(17-13)10(2)9-16-18;1-2-5-3-4/h4-9,16H,3H2,1-2H3;3H,2H2,1H3.
What are the key properties of ethyl formate;5-(4-ethylsulfanylphenyl)-3-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
ethyl formate;5-(4-ethylsulfanylphenyl)-3-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 359.45 g/mol, XLogP of 3.29, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;5-(4-ethylsulfanylphenyl)-3-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 164541054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).