About [2-[4-[di(propan-2-yl)amino]but-1-en-2-yl]benzene-3-id-1-yl] 3-iminobutanoate;manganese(2+)
[2-[4-[di(propan-2-yl)amino]but-1-en-2-yl]benzene-3-id-1-yl] 3-iminobutanoate;manganese(2+) (PubChem CID 164541107) has the molecular formula C20H28MnN2O2
and a molecular weight of 383.39 g/mol. Its IUPAC name is [2-[4-[di(propan-2-yl)amino]but-1-en-2-yl]benzene-3-id-1-yl] 3-iminobutanoate;manganese(2+).
Molecular Properties
| Compound Name | [2-[4-[di(propan-2-yl)amino]but-1-en-2-yl]benzene-3-id-1-yl] 3-iminobutanoate;manganese(2+) |
| PubChem CID | 164541107 |
| Molecular Formula | C20H28MnN2O2 |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | [2-[4-[di(propan-2-yl)amino]but-1-en-2-yl]benzene-3-id-1-yl] 3-iminobutanoate;manganese(2+) |
| SMILES | [H]/[C-]=C(\CCN(C(C)C)C(C)C)c1[c-]cccc1OC(=O)C/C(C)=N/[H].[Mn+2] |
| InChI | InChI=1S/C20H28N2O2.Mn/c1-14(2)22(15(3)4)12-11-16(5)18-9-7-8-10-19(18)24-20(23)13-17(6)21;/h5,7-8,10,14-15,21H,11-13H2,1-4,6H3;/q-2;+2/b21-17+; |
| InChIKey | UQSUJSHEPLJPRR-DIRYEVLESA-N |
| XLogP | 4.14 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[4-[di(propan-2-yl)amino]but-1-en-2-yl]benzene-3-id-1-yl] 3-iminobutanoate;manganese(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-[di(propan-2-yl)amino]but-1-en-2-yl]benzene-3-id-1-yl] 3-iminobutanoate;manganese(2+)?
The IUPAC name of [2-[4-[di(propan-2-yl)amino]but-1-en-2-yl]benzene-3-id-1-yl] 3-iminobutanoate;manganese(2+) (CID 164541107) is [2-[4-[di(propan-2-yl)amino]but-1-en-2-yl]benzene-3-id-1-yl] 3-iminobutanoate;manganese(2+).
What is the SMILES notation for [2-[4-[di(propan-2-yl)amino]but-1-en-2-yl]benzene-3-id-1-yl] 3-iminobutanoate;manganese(2+)?
The canonical SMILES for [2-[4-[di(propan-2-yl)amino]but-1-en-2-yl]benzene-3-id-1-yl] 3-iminobutanoate;manganese(2+) is [H]/[C-]=C(\CCN(C(C)C)C(C)C)c1[c-]cccc1OC(=O)C/C(C)=N/[H].[Mn+2].
What is the InChIKey of [2-[4-[di(propan-2-yl)amino]but-1-en-2-yl]benzene-3-id-1-yl] 3-iminobutanoate;manganese(2+)?
The InChIKey is UQSUJSHEPLJPRR-DIRYEVLESA-N. The full InChI is InChI=1S/C20H28N2O2.Mn/c1-14(2)22(15(3)4)12-11-16(5)18-9-7-8-10-19(18)24-20(23)13-17(6)21;/h5,7-8,10,14-15,21H,11-13H2,1-4,6H3;/q-2;+2/b21-17+;.
What are the key properties of [2-[4-[di(propan-2-yl)amino]but-1-en-2-yl]benzene-3-id-1-yl] 3-iminobutanoate;manganese(2+)?
[2-[4-[di(propan-2-yl)amino]but-1-en-2-yl]benzene-3-id-1-yl] 3-iminobutanoate;manganese(2+) has a molecular weight of 383.39 g/mol, XLogP of 4.14, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-[di(propan-2-yl)amino]but-1-en-2-yl]benzene-3-id-1-yl] 3-iminobutanoate;manganese(2+) is sourced from PubChem (CID 164541107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).