About 5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one
5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one (PubChem CID 164541114) has the molecular formula C6H10N4O2
and a molecular weight of 170.17 g/mol. Its IUPAC name is 5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one.
Molecular Properties
| Compound Name | 5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one |
| PubChem CID | 164541114 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one |
| SMILES | CC(C)n1ncc(NO)nc1=O |
| InChI | InChI=1S/C6H10N4O2/c1-4(2)10-6(11)8-5(9-12)3-7-10/h3-4,12H,1-2H3,(H,8,9,11) |
| InChIKey | HTPKASBOXASXMM-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one?
The IUPAC name of 5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one (CID 164541114) is 5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one.
What is the SMILES notation for 5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one?
The canonical SMILES for 5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one is CC(C)n1ncc(NO)nc1=O.
What is the InChIKey of 5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one?
The InChIKey is HTPKASBOXASXMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O2/c1-4(2)10-6(11)8-5(9-12)3-7-10/h3-4,12H,1-2H3,(H,8,9,11).
What are the key properties of 5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one?
5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one has a molecular weight of 170.17 g/mol, XLogP of 0.02, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one is sourced from PubChem (CID 164541114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).