C6H10N4O2 — CID 164541114
5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one (PubChem CID 164541114) has the molecular formula C6H10N4O2 and a molecular weight of 170.17 g/mol. Its IUPAC name is 5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one.
| Compound Name | 5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 164541114 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 5-(hydroxyamino)-2-propan-2-yl-1,2,4-triazin-3-one |
| SMILES | CC(C)n1ncc(NO)nc1=O |
| InChI | InChI=1S/C6H10N4O2/c1-4(2)10-6(11)8-5(9-12)3-7-10/h3-4,12H,1-2H3,(H,8,9,11) |
| InChIKey | HTPKASBOXASXMM-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|