C26H29F4N5OS — CID 164541313
1-[(2S,6R)-4-[3-amino-9-(4-fluorophenyl)-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1,5-benzothiazepine-6-carboximidoyl]-2,6-dimethylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 164541313) has the molecular formula C26H29F4N5OS and a molecular weight of 535.61 g/mol. Its IUPAC name is 1-[(2S,6R)-4-[3-amino-9-(4-fluorophenyl)-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1,5-benzothiazepine-6-carboximidoyl]-2,6-dimethylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2S,6R)-4-[3-amino-9-(4-fluorophenyl)-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1,5-benzothiazepine-6-carboximidoyl]-2,6-dimethylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 164541313 |
| Molecular Formula | C26H29F4N5OS |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 1-[(2S,6R)-4-[3-amino-9-(4-fluorophenyl)-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1,5-benzothiazepine-6-carboximidoyl]-2,6-dimethylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | [H]/N=C(/c1cc(C(F)(F)F)c(-c2ccc(F)cc2)c2c1NCC(N)CS2)N1C[C@@H](C)N(C(=O)C=C)[C@@H](C)C1 |
| InChI | InChI=1S/C26H29F4N5OS/c1-4-21(36)35-14(2)11-34(12-15(35)3)25(32)19-9-20(26(28,29)30)22(16-5-7-17(27)8-6-16)24-23(19)33-10-18(31)13-37-24/h4-9,14-15,18,32-33H,1,10-13,31H2,2-3H3/b32-25-/t14-,15+,18? |
| InChIKey | BLBUVLUMECEMIK-JOEDGBDMSA-N |
| XLogP | 4.79 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|