About methyl 2-amino-3-iodo-5-(trifluoromethyl)-4-[3-(trifluoromethyl)-1,2-thiazol-5-yl]benzoate
methyl 2-amino-3-iodo-5-(trifluoromethyl)-4-[3-(trifluoromethyl)-1,2-thiazol-5-yl]benzoate (PubChem CID 164541362) has the molecular formula C13H7F6IN2O2S
and a molecular weight of 496.17 g/mol. Its IUPAC name is methyl 2-amino-3-iodo-5-(trifluoromethyl)-4-[3-(trifluoromethyl)-1,2-thiazol-5-yl]benzoate.
Molecular Properties
| Compound Name | methyl 2-amino-3-iodo-5-(trifluoromethyl)-4-[3-(trifluoromethyl)-1,2-thiazol-5-yl]benzoate |
| PubChem CID | 164541362 |
| Molecular Formula | C13H7F6IN2O2S |
| Molecular Weight | 496.17 g/mol |
| Exact Mass | 495.92 |
| IUPAC Name | methyl 2-amino-3-iodo-5-(trifluoromethyl)-4-[3-(trifluoromethyl)-1,2-thiazol-5-yl]benzoate |
| SMILES | COC(=O)c1cc(C(F)(F)F)c(-c2cc(C(F)(F)F)ns2)c(I)c1N |
| InChI | InChI=1S/C13H7F6IN2O2S/c1-24-11(23)4-2-5(12(14,15)16)8(9(20)10(4)21)6-3-7(22-25-6)13(17,18)19/h2-3H,21H2,1H3 |
| InChIKey | CUBSSZCXTHYUKM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 496.17 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-3-iodo-5-(trifluoromethyl)-4-[3-(trifluoromethyl)-1,2-thiazol-5-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-3-iodo-5-(trifluoromethyl)-4-[3-(trifluoromethyl)-1,2-thiazol-5-yl]benzoate?
The IUPAC name of methyl 2-amino-3-iodo-5-(trifluoromethyl)-4-[3-(trifluoromethyl)-1,2-thiazol-5-yl]benzoate (CID 164541362) is methyl 2-amino-3-iodo-5-(trifluoromethyl)-4-[3-(trifluoromethyl)-1,2-thiazol-5-yl]benzoate.
What is the SMILES notation for methyl 2-amino-3-iodo-5-(trifluoromethyl)-4-[3-(trifluoromethyl)-1,2-thiazol-5-yl]benzoate?
The canonical SMILES for methyl 2-amino-3-iodo-5-(trifluoromethyl)-4-[3-(trifluoromethyl)-1,2-thiazol-5-yl]benzoate is COC(=O)c1cc(C(F)(F)F)c(-c2cc(C(F)(F)F)ns2)c(I)c1N.
What is the InChIKey of methyl 2-amino-3-iodo-5-(trifluoromethyl)-4-[3-(trifluoromethyl)-1,2-thiazol-5-yl]benzoate?
The InChIKey is CUBSSZCXTHYUKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F6IN2O2S/c1-24-11(23)4-2-5(12(14,15)16)8(9(20)10(4)21)6-3-7(22-25-6)13(17,18)19/h2-3H,21H2,1H3.
What are the key properties of methyl 2-amino-3-iodo-5-(trifluoromethyl)-4-[3-(trifluoromethyl)-1,2-thiazol-5-yl]benzoate?
methyl 2-amino-3-iodo-5-(trifluoromethyl)-4-[3-(trifluoromethyl)-1,2-thiazol-5-yl]benzoate has a molecular weight of 496.17 g/mol, XLogP of 4.82, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3-iodo-5-(trifluoromethyl)-4-[3-(trifluoromethyl)-1,2-thiazol-5-yl]benzoate is sourced from PubChem (CID 164541362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).