C16H16F4N2O2 — CID 164541942
2-amino-4-(5-fluoro-2-pyridinyl)-3-methyl-5-(trifluoromethyl)benzoic acid;ethane (PubChem CID 164541942) has the molecular formula C16H16F4N2O2 and a molecular weight of 344.31 g/mol. Its IUPAC name is 2-amino-4-(5-fluoro-2-pyridinyl)-3-methyl-5-(trifluoromethyl)benzoic acid;ethane.
| Compound Name | 2-amino-4-(5-fluoro-2-pyridinyl)-3-methyl-5-(trifluoromethyl)benzoic acid;ethane |
|---|---|
| PubChem CID | 164541942 |
| Molecular Formula | C16H16F4N2O2 |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-amino-4-(5-fluoro-2-pyridinyl)-3-methyl-5-(trifluoromethyl)benzoic acid;ethane |
| SMILES | CC.Cc1c(N)c(C(=O)O)cc(C(F)(F)F)c1-c1ccc(F)cn1 |
| InChI | InChI=1S/C14H10F4N2O2.C2H6/c1-6-11(10-3-2-7(15)5-20-10)9(14(16,17)18)4-8(12(6)19)13(21)22;1-2/h2-5H,19H2,1H3,(H,21,22);1-2H3 |
| InChIKey | FAYSNBDJJZECRB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|