About (E)-2-carbamimidoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enamide;ethane
(E)-2-carbamimidoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enamide;ethane (PubChem CID 164542772) has the molecular formula C11H22N4O2
and a molecular weight of 242.32 g/mol. Its IUPAC name is (E)-2-carbamimidoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enamide;ethane.
Molecular Properties
| Compound Name | (E)-2-carbamimidoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enamide;ethane |
| PubChem CID | 164542772 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (E)-2-carbamimidoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enamide;ethane |
| SMILES | CC.[H]/N=C(N)/C(=C\N[C@@H]1CCCOC1)C(N)=O |
| InChI | InChI=1S/C9H16N4O2.C2H6/c10-8(11)7(9(12)14)4-13-6-2-1-3-15-5-6;1-2/h4,6,13H,1-3,5H2,(H3,10,11)(H2,12,14);1-2H3/b7-4+;/t6-;/m1./s1 |
| InChIKey | LRFRFIJZAZFNFO-CCKJXMJGSA-N |
| XLogP | 0.09 |
| TPSA | 114.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-carbamimidoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-carbamimidoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enamide;ethane?
The IUPAC name of (E)-2-carbamimidoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enamide;ethane (CID 164542772) is (E)-2-carbamimidoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enamide;ethane.
What is the SMILES notation for (E)-2-carbamimidoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enamide;ethane?
The canonical SMILES for (E)-2-carbamimidoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enamide;ethane is CC.[H]/N=C(N)/C(=C\N[C@@H]1CCCOC1)C(N)=O.
What is the InChIKey of (E)-2-carbamimidoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enamide;ethane?
The InChIKey is LRFRFIJZAZFNFO-CCKJXMJGSA-N. The full InChI is InChI=1S/C9H16N4O2.C2H6/c10-8(11)7(9(12)14)4-13-6-2-1-3-15-5-6;1-2/h4,6,13H,1-3,5H2,(H3,10,11)(H2,12,14);1-2H3/b7-4+;/t6-;/m1./s1.
What are the key properties of (E)-2-carbamimidoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enamide;ethane?
(E)-2-carbamimidoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enamide;ethane has a molecular weight of 242.32 g/mol, XLogP of 0.09, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-carbamimidoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enamide;ethane is sourced from PubChem (CID 164542772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).