About acetylene;(E)-2-carbamimidoyl-3-(oxan-3-ylamino)prop-2-enamide
acetylene;(E)-2-carbamimidoyl-3-(oxan-3-ylamino)prop-2-enamide (PubChem CID 164542889) has the molecular formula C11H18N4O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is acetylene;(E)-2-carbamimidoyl-3-(oxan-3-ylamino)prop-2-enamide.
Molecular Properties
| Compound Name | acetylene;(E)-2-carbamimidoyl-3-(oxan-3-ylamino)prop-2-enamide |
| PubChem CID | 164542889 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | acetylene;(E)-2-carbamimidoyl-3-(oxan-3-ylamino)prop-2-enamide |
| SMILES | C#C.[H]/N=C(N)/C(=C\NC1CCCOC1)C(N)=O |
| InChI | InChI=1S/C9H16N4O2.C2H2/c10-8(11)7(9(12)14)4-13-6-2-1-3-15-5-6;1-2/h4,6,13H,1-3,5H2,(H3,10,11)(H2,12,14);1-2H/b7-4+; |
| InChIKey | XDOBIMXVLFWCCQ-KQGICBIGSA-N |
| XLogP | -0.69 |
| TPSA | 114.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;(E)-2-carbamimidoyl-3-(oxan-3-ylamino)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;(E)-2-carbamimidoyl-3-(oxan-3-ylamino)prop-2-enamide?
The IUPAC name of acetylene;(E)-2-carbamimidoyl-3-(oxan-3-ylamino)prop-2-enamide (CID 164542889) is acetylene;(E)-2-carbamimidoyl-3-(oxan-3-ylamino)prop-2-enamide.
What is the SMILES notation for acetylene;(E)-2-carbamimidoyl-3-(oxan-3-ylamino)prop-2-enamide?
The canonical SMILES for acetylene;(E)-2-carbamimidoyl-3-(oxan-3-ylamino)prop-2-enamide is C#C.[H]/N=C(N)/C(=C\NC1CCCOC1)C(N)=O.
What is the InChIKey of acetylene;(E)-2-carbamimidoyl-3-(oxan-3-ylamino)prop-2-enamide?
The InChIKey is XDOBIMXVLFWCCQ-KQGICBIGSA-N. The full InChI is InChI=1S/C9H16N4O2.C2H2/c10-8(11)7(9(12)14)4-13-6-2-1-3-15-5-6;1-2/h4,6,13H,1-3,5H2,(H3,10,11)(H2,12,14);1-2H/b7-4+;.
What are the key properties of acetylene;(E)-2-carbamimidoyl-3-(oxan-3-ylamino)prop-2-enamide?
acetylene;(E)-2-carbamimidoyl-3-(oxan-3-ylamino)prop-2-enamide has a molecular weight of 238.29 g/mol, XLogP of -0.69, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;(E)-2-carbamimidoyl-3-(oxan-3-ylamino)prop-2-enamide is sourced from PubChem (CID 164542889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).