C35H42F5N5O3 — CID 164543447
1-[[3-[(2E,4Z)-5-amino-3-[4-(2-propan-2-yloxyethoxy)phenyl]penta-2,4-dienyl]-5-[6-(trifluoromethyl)-3-pyridinyl]phenyl]methyl]-4,4-difluoropiperidin-3-amine;formamide (PubChem CID 164543447) has the molecular formula C35H42F5N5O3 and a molecular weight of 675.74 g/mol. Its IUPAC name is 1-[[3-[(2E,4Z)-5-amino-3-[4-(2-propan-2-yloxyethoxy)phenyl]penta-2,4-dienyl]-5-[6-(trifluoromethyl)-3-pyridinyl]phenyl]methyl]-4,4-difluoropiperidin-3-amine;formamide.
| Compound Name | 1-[[3-[(2E,4Z)-5-amino-3-[4-(2-propan-2-yloxyethoxy)phenyl]penta-2,4-dienyl]-5-[6-(trifluoromethyl)-3-pyridinyl]phenyl]methyl]-4,4-difluoropiperidin-3-amine;formamide |
|---|---|
| PubChem CID | 164543447 |
| Molecular Formula | C35H42F5N5O3 |
| Molecular Weight | 675.74 g/mol |
| Exact Mass | 675.32 |
| IUPAC Name | 1-[[3-[(2E,4Z)-5-amino-3-[4-(2-propan-2-yloxyethoxy)phenyl]penta-2,4-dienyl]-5-[6-(trifluoromethyl)-3-pyridinyl]phenyl]methyl]-4,4-difluoropiperidin-3-amine;formamide |
| SMILES | CC(C)OCCOc1ccc(C(/C=C\N)=C/Cc2cc(CN3CCC(F)(F)C(N)C3)cc(-c3ccc(C(F)(F)F)nc3)c2)cc1.NC=O |
| InChI | InChI=1S/C34H39F5N4O2.CH3NO/c1-23(2)44-15-16-45-30-8-5-26(6-9-30)27(11-13-40)4-3-24-17-25(21-43-14-12-33(35,36)31(41)22-43)19-29(18-24)28-7-10-32(42-20-28)34(37,38)39;2-1-3/h4-11,13,17-20,23,31H,3,12,14-16,21-22,40-41H2,1-2H3;1H,(H2,2,3)/b13-11-,27-4+; |
| InChIKey | YEHZYZUHKQWOSK-DTWSDDNSSA-N |
| XLogP | 5.94 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.74 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|