C18H27N5 — CID 164543483
N-methyl-1-[[3-(methylamino)-5-(4-methylimidazol-1-yl)phenyl]methyl]piperidin-3-amine (PubChem CID 164543483) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is N-methyl-1-[[3-(methylamino)-5-(4-methylimidazol-1-yl)phenyl]methyl]piperidin-3-amine.
| Compound Name | N-methyl-1-[[3-(methylamino)-5-(4-methylimidazol-1-yl)phenyl]methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 164543483 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | N-methyl-1-[[3-(methylamino)-5-(4-methylimidazol-1-yl)phenyl]methyl]piperidin-3-amine |
| SMILES | CNc1cc(CN2CCCC(NC)C2)cc(-n2cnc(C)c2)c1 |
| InChI | InChI=1S/C18H27N5/c1-14-10-23(13-21-14)18-8-15(7-17(9-18)20-3)11-22-6-4-5-16(12-22)19-2/h7-10,13,16,19-20H,4-6,11-12H2,1-3H3 |
| InChIKey | USCKLGNLUNNHKL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |