C20H28O4S — CID 164543723
2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(3-methylsulfonylpropyl)benzene-1,3-diol (PubChem CID 164543723) has the molecular formula C20H28O4S and a molecular weight of 364.51 g/mol. Its IUPAC name is 2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(3-methylsulfonylpropyl)benzene-1,3-diol.
| Compound Name | 2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(3-methylsulfonylpropyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 164543723 |
| Molecular Formula | C20H28O4S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(3-methylsulfonylpropyl)benzene-1,3-diol |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCS(C)(=O)=O)cc1O |
| InChI | InChI=1S/C20H28O4S/c1-13(2)16-8-7-14(3)10-17(16)20-18(21)11-15(12-19(20)22)6-5-9-25(4,23)24/h10-12,16-17,21-22H,1,5-9H2,2-4H3/t16-,17+/m0/s1 |
| InChIKey | YGYKHSYKRMFOMS-DLBZAZTESA-N |
| XLogP | 4.09 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|