C32H36F3N5O7 — CID 164544035
[(3S)-3-[[(2S)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]-4-methylpentanoyl]amino]-2-oxo-4-(2-oxopiperidin-3-yl)butyl] 2-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 164544035) has the molecular formula C32H36F3N5O7 and a molecular weight of 659.66 g/mol. Its IUPAC name is [(3S)-3-[[(2S)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]-4-methylpentanoyl]amino]-2-oxo-4-(2-oxopiperidin-3-yl)butyl] 2-(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | [(3S)-3-[[(2S)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]-4-methylpentanoyl]amino]-2-oxo-4-(2-oxopiperidin-3-yl)butyl] 2-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 164544035 |
| Molecular Formula | C32H36F3N5O7 |
| Molecular Weight | 659.66 g/mol |
| Exact Mass | 659.26 |
| IUPAC Name | [(3S)-3-[[(2S)-2-[(4-methoxy-1H-indole-2-carbonyl)amino]-4-methylpentanoyl]amino]-2-oxo-4-(2-oxopiperidin-3-yl)butyl] 2-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | COc1cccc2[nH]c(C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC3CCCNC3=O)C(=O)COC(=O)c3cccnc3C(F)(F)F)cc12 |
| InChI | InChI=1S/C32H36F3N5O7/c1-17(2)13-23(40-30(44)24-15-20-21(38-24)9-4-10-26(20)46-3)29(43)39-22(14-18-7-5-12-37-28(18)42)25(41)16-47-31(45)19-8-6-11-36-27(19)32(33,34)35/h4,6,8-11,15,17-18,22-23,38H,5,7,12-14,16H2,1-3H3,(H,37,42)(H,39,43)(H,40,44)/t18?,22-,23-/m0/s1 |
| InChIKey | LREBETVECMNWOO-BFLQJQPQSA-N |
| XLogP | 3.56 |
| TPSA | 168.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.66 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |