C18H16F6N3O3P — CID 164544656
7-dimethylphosphoryl-5-methoxy-3-[2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)pyrimidin-4-yl]-1H-indole (PubChem CID 164544656) has the molecular formula C18H16F6N3O3P and a molecular weight of 467.31 g/mol. Its IUPAC name is 7-dimethylphosphoryl-5-methoxy-3-[2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)pyrimidin-4-yl]-1H-indole.
| Compound Name | 7-dimethylphosphoryl-5-methoxy-3-[2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)pyrimidin-4-yl]-1H-indole |
|---|---|
| PubChem CID | 164544656 |
| Molecular Formula | C18H16F6N3O3P |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 7-dimethylphosphoryl-5-methoxy-3-[2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)pyrimidin-4-yl]-1H-indole |
| SMILES | COc1cc(P(C)(C)=O)c2[nH]cc(-c3nc(OCC(F)(F)F)ncc3C(F)(F)F)c2c1 |
| InChI | InChI=1S/C18H16F6N3O3P/c1-29-9-4-10-11(6-25-15(10)13(5-9)31(2,3)28)14-12(18(22,23)24)7-26-16(27-14)30-8-17(19,20)21/h4-7,25H,8H2,1-3H3 |
| InChIKey | AGYLIIPKEUSJQX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|