C12H13BrN2O3S — CID 164544914
methyl 2-(bromomethyl)-1-[[(2S)-oxetan-2-yl]methyl]thieno[2,3-d]imidazole-5-carboxylate (PubChem CID 164544914) has the molecular formula C12H13BrN2O3S and a molecular weight of 345.22 g/mol. Its IUPAC name is methyl 2-(bromomethyl)-1-[[(2S)-oxetan-2-yl]methyl]thieno[2,3-d]imidazole-5-carboxylate.
| Compound Name | methyl 2-(bromomethyl)-1-[[(2S)-oxetan-2-yl]methyl]thieno[2,3-d]imidazole-5-carboxylate |
|---|---|
| PubChem CID | 164544914 |
| Molecular Formula | C12H13BrN2O3S |
| Molecular Weight | 345.22 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | methyl 2-(bromomethyl)-1-[[(2S)-oxetan-2-yl]methyl]thieno[2,3-d]imidazole-5-carboxylate |
| SMILES | COC(=O)c1cc2c(nc(CBr)n2C[C@@H]2CCO2)s1 |
| InChI | InChI=1S/C12H13BrN2O3S/c1-17-12(16)9-4-8-11(19-9)14-10(5-13)15(8)6-7-2-3-18-7/h4,7H,2-3,5-6H2,1H3/t7-/m0/s1 |
| InChIKey | KSIRAKMYTMKTDP-ZETCQYMHSA-N |
| XLogP | 2.57 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|