C28H36N6O4S — CID 164545384
1-[3-[4-[(5R)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5,7-dimethyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]piperidin-1-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 164545384) has the molecular formula C28H36N6O4S and a molecular weight of 552.70 g/mol. Its IUPAC name is 1-[3-[4-[(5R)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5,7-dimethyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]piperidin-1-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-[(5R)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5,7-dimethyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]piperidin-1-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 164545384 |
| Molecular Formula | C28H36N6O4S |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | 1-[3-[4-[(5R)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5,7-dimethyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]piperidin-1-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(N2CCC(c3cc(C)c4c(c3)Nc3ncnc(N5CCS(=O)(=O)CC5)c3[C@@H](C)O4)CC2)C1 |
| InChI | InChI=1S/C28H36N6O4S/c1-4-24(35)34-15-22(16-34)32-7-5-20(6-8-32)21-13-18(2)26-23(14-21)31-27-25(19(3)38-26)28(30-17-29-27)33-9-11-39(36,37)12-10-33/h4,13-14,17,19-20,22H,1,5-12,15-16H2,2-3H3,(H,29,30,31)/t19-/m1/s1 |
| InChIKey | GEJQJTGWWUQEMM-LJQANCHMSA-N |
| XLogP | 2.79 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|