C29H36N6O4S — CID 164545458
1-[(3R)-3-[3-[(5R)-7-cyclopropyl-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5-methyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]azetidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 164545458) has the molecular formula C29H36N6O4S and a molecular weight of 564.71 g/mol. Its IUPAC name is 1-[(3R)-3-[3-[(5R)-7-cyclopropyl-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5-methyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]azetidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[3-[(5R)-7-cyclopropyl-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5-methyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]azetidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 164545458 |
| Molecular Formula | C29H36N6O4S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | 1-[(3R)-3-[3-[(5R)-7-cyclopropyl-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5-methyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]azetidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@@H](N2CC(c3cc4c(c(C5CC5)c3)O[C@H](C)c3c(ncnc3N3CCS(=O)(=O)CC3)N4)C2)C1 |
| InChI | InChI=1S/C29H36N6O4S/c1-3-25(36)34-7-6-22(16-34)35-14-21(15-35)20-12-23(19-4-5-19)27-24(13-20)32-28-26(18(2)39-27)29(31-17-30-28)33-8-10-40(37,38)11-9-33/h3,12-13,17-19,21-22H,1,4-11,14-16H2,2H3,(H,30,31,32)/t18-,22-/m1/s1 |
| InChIKey | LFBZELDFKFUREF-XMSQKQJNSA-N |
| XLogP | 2.97 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|