C29H36N6O3S — CID 164545485
4-[7-methyl-9-[1-(1-pent-1-en-3-yn-2-ylazetidin-3-yl)piperidin-4-yl]-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl]-1,4-thiazinane 1,1-dioxide (PubChem CID 164545485) has the molecular formula C29H36N6O3S and a molecular weight of 548.71 g/mol. Its IUPAC name is 4-[7-methyl-9-[1-(1-pent-1-en-3-yn-2-ylazetidin-3-yl)piperidin-4-yl]-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[7-methyl-9-[1-(1-pent-1-en-3-yn-2-ylazetidin-3-yl)piperidin-4-yl]-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 164545485 |
| Molecular Formula | C29H36N6O3S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | 4-[7-methyl-9-[1-(1-pent-1-en-3-yn-2-ylazetidin-3-yl)piperidin-4-yl]-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl]-1,4-thiazinane 1,1-dioxide |
| SMILES | C=C(C#CC)N1CC(N2CCC(c3cc(C)c4c(c3)Nc3ncnc(N5CCS(=O)(=O)CC5)c3CO4)CC2)C1 |
| InChI | InChI=1S/C29H36N6O3S/c1-4-5-21(3)35-16-24(17-35)33-8-6-22(7-9-33)23-14-20(2)27-26(15-23)32-28-25(18-38-27)29(31-19-30-28)34-10-12-39(36,37)13-11-34/h14-15,19,22,24H,3,6-13,16-18H2,1-2H3,(H,30,31,32) |
| InChIKey | AIFRVPJTNCDZGI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|