C28H34N6O4S — CID 164545885
1-[3-[3-[(5R)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5,7-dimethyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]azetidin-1-yl]pyrrolidin-1-yl]but-2-yn-1-one (PubChem CID 164545885) has the molecular formula C28H34N6O4S and a molecular weight of 550.69 g/mol. Its IUPAC name is 1-[3-[3-[(5R)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5,7-dimethyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]azetidin-1-yl]pyrrolidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[3-[3-[(5R)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5,7-dimethyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]azetidin-1-yl]pyrrolidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 164545885 |
| Molecular Formula | C28H34N6O4S |
| Molecular Weight | 550.69 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 1-[3-[3-[(5R)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5,7-dimethyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]azetidin-1-yl]pyrrolidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCC(N2CC(c3cc(C)c4c(c3)Nc3ncnc(N5CCS(=O)(=O)CC5)c3[C@@H](C)O4)C2)C1 |
| InChI | InChI=1S/C28H34N6O4S/c1-4-5-24(35)33-7-6-22(16-33)34-14-21(15-34)20-12-18(2)26-23(13-20)31-27-25(19(3)38-26)28(30-17-29-27)32-8-10-39(36,37)11-9-32/h12-13,17,19,21-22H,6-11,14-16H2,1-3H3,(H,29,30,31)/t19-,22?/m1/s1 |
| InChIKey | IRYADJLUIMPLBE-LCQOSCCDSA-N |
| XLogP | 2.24 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.69 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|