C23H25ClFN5O — CID 164546101
N-[5-[6-(5-chloro-2-fluorophenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-8-yl]-3-pyridinyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 164546101) has the molecular formula C23H25ClFN5O and a molecular weight of 441.94 g/mol. Its IUPAC name is N-[5-[6-(5-chloro-2-fluorophenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-8-yl]-3-pyridinyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[5-[6-(5-chloro-2-fluorophenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-8-yl]-3-pyridinyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 164546101 |
| Molecular Formula | C23H25ClFN5O |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-[5-[6-(5-chloro-2-fluorophenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-8-yl]-3-pyridinyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1cncc(-c2cc(-c3cc(Cl)ccc3F)nc3c2OCCN3)c1 |
| InChI | InChI=1S/C23H25ClFN5O/c1-30(2)8-3-6-27-17-10-15(13-26-14-17)18-12-21(19-11-16(24)4-5-20(19)25)29-23-22(18)31-9-7-28-23/h4-5,10-14,27H,3,6-9H2,1-2H3,(H,28,29) |
| InChIKey | OLKFGVPFKLGRES-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|