C18H30O2 — CID 164546813
(1-ethyl-3,4,5,5a,6,7,8,9,10,10a-decahydro-2H-heptalen-1-yl) 2-methylprop-2-enoate (PubChem CID 164546813) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (1-ethyl-3,4,5,5a,6,7,8,9,10,10a-decahydro-2H-heptalen-1-yl) 2-methylprop-2-enoate.
| Compound Name | (1-ethyl-3,4,5,5a,6,7,8,9,10,10a-decahydro-2H-heptalen-1-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 164546813 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (1-ethyl-3,4,5,5a,6,7,8,9,10,10a-decahydro-2H-heptalen-1-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(CC)CCCCC2CCCCCC21 |
| InChI | InChI=1S/C18H30O2/c1-4-18(20-17(19)14(2)3)13-9-8-11-15-10-6-5-7-12-16(15)18/h15-16H,2,4-13H2,1,3H3 |
| InChIKey | HBDXRXANKBRFSB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|