About 4-bromo-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazole
4-bromo-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazole (PubChem CID 164547290) has the molecular formula C10H15BrN2O2
and a molecular weight of 275.15 g/mol. Its IUPAC name is 4-bromo-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazole.
Molecular Properties
| Compound Name | 4-bromo-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazole |
| PubChem CID | 164547290 |
| Molecular Formula | C10H15BrN2O2 |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 4-bromo-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazole |
| SMILES | CC1(C)OCC(CCn2cc(Br)cn2)O1 |
| InChI | InChI=1S/C10H15BrN2O2/c1-10(2)14-7-9(15-10)3-4-13-6-8(11)5-12-13/h5-6,9H,3-4,7H2,1-2H3 |
| InChIKey | HVNNZOHBENXAQL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazole?
The IUPAC name of 4-bromo-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazole (CID 164547290) is 4-bromo-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazole.
What is the SMILES notation for 4-bromo-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazole?
The canonical SMILES for 4-bromo-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazole is CC1(C)OCC(CCn2cc(Br)cn2)O1.
What is the InChIKey of 4-bromo-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazole?
The InChIKey is HVNNZOHBENXAQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BrN2O2/c1-10(2)14-7-9(15-10)3-4-13-6-8(11)5-12-13/h5-6,9H,3-4,7H2,1-2H3.
What are the key properties of 4-bromo-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazole?
4-bromo-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazole has a molecular weight of 275.15 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazole is sourced from PubChem (CID 164547290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).