C16H14BrN5O3S — CID 164547326
tert-butyl N-(13-bromo-9-oxo-12-thia-3,8,15,16-tetrazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(16),2(7),3,5,10,13-hexaen-5-yl)carbamate (PubChem CID 164547326) has the molecular formula C16H14BrN5O3S and a molecular weight of 436.29 g/mol. Its IUPAC name is tert-butyl N-(13-bromo-9-oxo-12-thia-3,8,15,16-tetrazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(16),2(7),3,5,10,13-hexaen-5-yl)carbamate.
| Compound Name | tert-butyl N-(13-bromo-9-oxo-12-thia-3,8,15,16-tetrazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(16),2(7),3,5,10,13-hexaen-5-yl)carbamate |
|---|---|
| PubChem CID | 164547326 |
| Molecular Formula | C16H14BrN5O3S |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | tert-butyl N-(13-bromo-9-oxo-12-thia-3,8,15,16-tetrazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(16),2(7),3,5,10,13-hexaen-5-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cnc2c(c1)[nH]c(=O)c1c2nn2cc(Br)sc12 |
| InChI | InChI=1S/C16H14BrN5O3S/c1-16(2,3)25-15(24)19-7-4-8-11(18-5-7)12-10(13(23)20-8)14-22(21-12)6-9(17)26-14/h4-6H,1-3H3,(H,19,24)(H,20,23) |
| InChIKey | BNACKMRMTWYUGR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |