C16H13ClF3N5O — CID 164548645
(1R,9S)-N-[4-chloro-5-(trifluoromethyl)-2-pyridinyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide (PubChem CID 164548645) has the molecular formula C16H13ClF3N5O and a molecular weight of 383.76 g/mol. Its IUPAC name is (1R,9S)-N-[4-chloro-5-(trifluoromethyl)-2-pyridinyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide.
| Compound Name | (1R,9S)-N-[4-chloro-5-(trifluoromethyl)-2-pyridinyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 164548645 |
| Molecular Formula | C16H13ClF3N5O |
| Molecular Weight | 383.76 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | (1R,9S)-N-[4-chloro-5-(trifluoromethyl)-2-pyridinyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(C(F)(F)F)cn1)N1[C@H]2CC[C@@H]1c1cncnc1C2 |
| InChI | InChI=1S/C16H13ClF3N5O/c17-11-4-14(22-6-10(11)16(18,19)20)24-15(26)25-8-1-2-13(25)9-5-21-7-23-12(9)3-8/h4-8,13H,1-3H2,(H,22,24,26)/t8-,13+/m0/s1 |
| InChIKey | XANOICIYNFMTES-ISVAXAHUSA-N |
| XLogP | 3.84 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.76 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |