C14H22N4O3 — CID 164549463
2-[[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 164549463) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-[[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 164549463 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-[[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | NC(Cc1cnc[nH]1)C(=O)NCC1CCCCC1C(=O)O |
| InChI | InChI=1S/C14H22N4O3/c15-12(5-10-7-16-8-18-10)13(19)17-6-9-3-1-2-4-11(9)14(20)21/h7-9,11-12H,1-6,15H2,(H,16,18)(H,17,19)(H,20,21) |
| InChIKey | VEXUAHZASIJXNP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |