C33H39NO3S2Si — CID 164550791
(E,3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-[tert-butyl(diphenyl)silyl]oxy-3-hydroxyhept-4-en-1-one (PubChem CID 164550791) has the molecular formula C33H39NO3S2Si and a molecular weight of 589.90 g/mol. Its IUPAC name is (E,3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-[tert-butyl(diphenyl)silyl]oxy-3-hydroxyhept-4-en-1-one.
| Compound Name | (E,3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-[tert-butyl(diphenyl)silyl]oxy-3-hydroxyhept-4-en-1-one |
|---|---|
| PubChem CID | 164550791 |
| Molecular Formula | C33H39NO3S2Si |
| Molecular Weight | 589.90 g/mol |
| Exact Mass | 589.21 |
| IUPAC Name | (E,3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-[tert-butyl(diphenyl)silyl]oxy-3-hydroxyhept-4-en-1-one |
| SMILES | CC(C)(C)[Si](OCC/C=C/[C@@H](O)CC(=O)N1C(=S)SC[C@H]1Cc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H39NO3S2Si/c1-33(2,3)40(29-18-9-5-10-19-29,30-20-11-6-12-21-30)37-22-14-13-17-28(35)24-31(36)34-27(25-39-32(34)38)23-26-15-7-4-8-16-26/h4-13,15-21,27-28,35H,14,22-25H2,1-3H3/b17-13+/t27-,28-/m1/s1 |
| InChIKey | VCEUTWDEOWSHQE-IDNKZKLPSA-N |
| XLogP | 5.73 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.90 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|