C24H28F5N3O4S — CID 164550879
(6R)-3-[5-(difluoromethoxy)-2-fluorophenyl]-1-(1,1-difluoropropan-2-yl)-N-(4-methyl-1,1-dioxothian-4-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide (PubChem CID 164550879) has the molecular formula C24H28F5N3O4S and a molecular weight of 549.56 g/mol. Its IUPAC name is (6R)-3-[5-(difluoromethoxy)-2-fluorophenyl]-1-(1,1-difluoropropan-2-yl)-N-(4-methyl-1,1-dioxothian-4-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide.
| Compound Name | (6R)-3-[5-(difluoromethoxy)-2-fluorophenyl]-1-(1,1-difluoropropan-2-yl)-N-(4-methyl-1,1-dioxothian-4-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide |
|---|---|
| PubChem CID | 164550879 |
| Molecular Formula | C24H28F5N3O4S |
| Molecular Weight | 549.56 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | (6R)-3-[5-(difluoromethoxy)-2-fluorophenyl]-1-(1,1-difluoropropan-2-yl)-N-(4-methyl-1,1-dioxothian-4-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide |
| SMILES | CC(C(F)F)n1nc(-c2cc(OC(F)F)ccc2F)c2c1C[C@H](C(=O)NC1(C)CCS(=O)(=O)CC1)CC2 |
| InChI | InChI=1S/C24H28F5N3O4S/c1-13(21(26)27)32-19-11-14(22(33)30-24(2)7-9-37(34,35)10-8-24)3-5-16(19)20(31-32)17-12-15(36-23(28)29)4-6-18(17)25/h4,6,12-14,21,23H,3,5,7-11H2,1-2H3,(H,30,33)/t13?,14-/m1/s1 |
| InChIKey | YIIHLUROESRMCX-ARLHGKGLSA-N |
| XLogP | 4.31 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |