C23H34F4N4O2S — CID 164551028
ethane;N-(3-methylthietan-3-yl)hydroxylamine;1-propan-2-yl-3-[5-(1,1,2,2-tetrafluoroethoxy)-3-pyridinyl]-4,5,6,7-tetrahydroindazole (PubChem CID 164551028) has the molecular formula C23H34F4N4O2S and a molecular weight of 506.61 g/mol. Its IUPAC name is ethane;N-(3-methylthietan-3-yl)hydroxylamine;1-propan-2-yl-3-[5-(1,1,2,2-tetrafluoroethoxy)-3-pyridinyl]-4,5,6,7-tetrahydroindazole.
| Compound Name | ethane;N-(3-methylthietan-3-yl)hydroxylamine;1-propan-2-yl-3-[5-(1,1,2,2-tetrafluoroethoxy)-3-pyridinyl]-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 164551028 |
| Molecular Formula | C23H34F4N4O2S |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | ethane;N-(3-methylthietan-3-yl)hydroxylamine;1-propan-2-yl-3-[5-(1,1,2,2-tetrafluoroethoxy)-3-pyridinyl]-4,5,6,7-tetrahydroindazole |
| SMILES | CC.CC(C)n1nc(-c2cncc(OC(F)(F)C(F)F)c2)c2c1CCCC2.CC1(NO)CSC1 |
| InChI | InChI=1S/C17H19F4N3O.C4H9NOS.C2H6/c1-10(2)24-14-6-4-3-5-13(14)15(23-24)11-7-12(9-22-8-11)25-17(20,21)16(18)19;1-4(5-6)2-7-3-4;1-2/h7-10,16H,3-6H2,1-2H3;5-6H,2-3H2,1H3;1-2H3 |
| InChIKey | XUSLZUYFXFUQGF-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|