About ethane;4-ethyl-N,N-dimethylbenzenesulfinamide
ethane;4-ethyl-N,N-dimethylbenzenesulfinamide (PubChem CID 164551718) has the molecular formula C12H21NOS
and a molecular weight of 227.37 g/mol. Its IUPAC name is ethane;4-ethyl-N,N-dimethylbenzenesulfinamide.
Molecular Properties
| Compound Name | ethane;4-ethyl-N,N-dimethylbenzenesulfinamide |
| PubChem CID | 164551718 |
| Molecular Formula | C12H21NOS |
| Molecular Weight | 227.37 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | ethane;4-ethyl-N,N-dimethylbenzenesulfinamide |
| SMILES | CC.CCc1ccc(S(=O)N(C)C)cc1 |
| InChI | InChI=1S/C10H15NOS.C2H6/c1-4-9-5-7-10(8-6-9)13(12)11(2)3;1-2/h5-8H,4H2,1-3H3;1-2H3 |
| InChIKey | ZAASGOMJUOYWQG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-ethyl-N,N-dimethylbenzenesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethyl-N,N-dimethylbenzenesulfinamide?
The IUPAC name of ethane;4-ethyl-N,N-dimethylbenzenesulfinamide (CID 164551718) is ethane;4-ethyl-N,N-dimethylbenzenesulfinamide.
What is the SMILES notation for ethane;4-ethyl-N,N-dimethylbenzenesulfinamide?
The canonical SMILES for ethane;4-ethyl-N,N-dimethylbenzenesulfinamide is CC.CCc1ccc(S(=O)N(C)C)cc1.
What is the InChIKey of ethane;4-ethyl-N,N-dimethylbenzenesulfinamide?
The InChIKey is ZAASGOMJUOYWQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NOS.C2H6/c1-4-9-5-7-10(8-6-9)13(12)11(2)3;1-2/h5-8H,4H2,1-3H3;1-2H3.
What are the key properties of ethane;4-ethyl-N,N-dimethylbenzenesulfinamide?
ethane;4-ethyl-N,N-dimethylbenzenesulfinamide has a molecular weight of 227.37 g/mol, XLogP of 2.86, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethyl-N,N-dimethylbenzenesulfinamide is sourced from PubChem (CID 164551718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).