About 9-ethyl-9-methyl-4,7-diazaspiro[2.6]nonane
9-ethyl-9-methyl-4,7-diazaspiro[2.6]nonane (PubChem CID 164553946) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 9-ethyl-9-methyl-4,7-diazaspiro[2.6]nonane.
Molecular Properties
| Compound Name | 9-ethyl-9-methyl-4,7-diazaspiro[2.6]nonane |
| PubChem CID | 164553946 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 9-ethyl-9-methyl-4,7-diazaspiro[2.6]nonane |
| SMILES | CCC1(C)CNCCNC12CC2 |
| InChI | InChI=1S/C10H20N2/c1-3-9(2)8-11-6-7-12-10(9)4-5-10/h11-12H,3-8H2,1-2H3 |
| InChIKey | WGBOKKJTKQXGJT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-ethyl-9-methyl-4,7-diazaspiro[2.6]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-9-methyl-4,7-diazaspiro[2.6]nonane?
The IUPAC name of 9-ethyl-9-methyl-4,7-diazaspiro[2.6]nonane (CID 164553946) is 9-ethyl-9-methyl-4,7-diazaspiro[2.6]nonane.
What is the SMILES notation for 9-ethyl-9-methyl-4,7-diazaspiro[2.6]nonane?
The canonical SMILES for 9-ethyl-9-methyl-4,7-diazaspiro[2.6]nonane is CCC1(C)CNCCNC12CC2.
What is the InChIKey of 9-ethyl-9-methyl-4,7-diazaspiro[2.6]nonane?
The InChIKey is WGBOKKJTKQXGJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-3-9(2)8-11-6-7-12-10(9)4-5-10/h11-12H,3-8H2,1-2H3.
What are the key properties of 9-ethyl-9-methyl-4,7-diazaspiro[2.6]nonane?
9-ethyl-9-methyl-4,7-diazaspiro[2.6]nonane has a molecular weight of 168.28 g/mol, XLogP of 1.13, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-9-methyl-4,7-diazaspiro[2.6]nonane is sourced from PubChem (CID 164553946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).