About N-butan-2-yl-5,5,5-trifluoro-2-methylidenepentanamide
N-butan-2-yl-5,5,5-trifluoro-2-methylidenepentanamide (PubChem CID 164554142) has the molecular formula C10H16F3NO
and a molecular weight of 223.24 g/mol. Its IUPAC name is N-butan-2-yl-5,5,5-trifluoro-2-methylidenepentanamide.
Molecular Properties
| Compound Name | N-butan-2-yl-5,5,5-trifluoro-2-methylidenepentanamide |
| PubChem CID | 164554142 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | N-butan-2-yl-5,5,5-trifluoro-2-methylidenepentanamide |
| SMILES | C=C(CCC(F)(F)F)C(=O)NC(C)CC |
| InChI | InChI=1S/C10H16F3NO/c1-4-8(3)14-9(15)7(2)5-6-10(11,12)13/h8H,2,4-6H2,1,3H3,(H,14,15) |
| InChIKey | LLMFXAVLKCKTPS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-yl-5,5,5-trifluoro-2-methylidenepentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-5,5,5-trifluoro-2-methylidenepentanamide?
The IUPAC name of N-butan-2-yl-5,5,5-trifluoro-2-methylidenepentanamide (CID 164554142) is N-butan-2-yl-5,5,5-trifluoro-2-methylidenepentanamide.
What is the SMILES notation for N-butan-2-yl-5,5,5-trifluoro-2-methylidenepentanamide?
The canonical SMILES for N-butan-2-yl-5,5,5-trifluoro-2-methylidenepentanamide is C=C(CCC(F)(F)F)C(=O)NC(C)CC.
What is the InChIKey of N-butan-2-yl-5,5,5-trifluoro-2-methylidenepentanamide?
The InChIKey is LLMFXAVLKCKTPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3NO/c1-4-8(3)14-9(15)7(2)5-6-10(11,12)13/h8H,2,4-6H2,1,3H3,(H,14,15).
What are the key properties of N-butan-2-yl-5,5,5-trifluoro-2-methylidenepentanamide?
N-butan-2-yl-5,5,5-trifluoro-2-methylidenepentanamide has a molecular weight of 223.24 g/mol, XLogP of 2.80, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-5,5,5-trifluoro-2-methylidenepentanamide is sourced from PubChem (CID 164554142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).