About dimethyl 2-[(E)-3-[[(1R,2S)-2-methylcyclopropyl]amino]prop-2-enylidene]propanedioate
dimethyl 2-[(E)-3-[[(1R,2S)-2-methylcyclopropyl]amino]prop-2-enylidene]propanedioate (PubChem CID 164554721) has the molecular formula C12H17NO4
and a molecular weight of 239.27 g/mol. Its IUPAC name is dimethyl 2-[(E)-3-[[(1R,2S)-2-methylcyclopropyl]amino]prop-2-enylidene]propanedioate.
Molecular Properties
| Compound Name | dimethyl 2-[(E)-3-[[(1R,2S)-2-methylcyclopropyl]amino]prop-2-enylidene]propanedioate |
| PubChem CID | 164554721 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | dimethyl 2-[(E)-3-[[(1R,2S)-2-methylcyclopropyl]amino]prop-2-enylidene]propanedioate |
| SMILES | COC(=O)C(=C/C=C/N[C@@H]1C[C@@H]1C)C(=O)OC |
| InChI | InChI=1S/C12H17NO4/c1-8-7-10(8)13-6-4-5-9(11(14)16-2)12(15)17-3/h4-6,8,10,13H,7H2,1-3H3/b6-4+/t8-,10+/m0/s1 |
| InChIKey | MPOWWPXXPDMORL-WUQHTFKHSA-N |
| XLogP | 0.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[(E)-3-[[(1R,2S)-2-methylcyclopropyl]amino]prop-2-enylidene]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[(E)-3-[[(1R,2S)-2-methylcyclopropyl]amino]prop-2-enylidene]propanedioate?
The IUPAC name of dimethyl 2-[(E)-3-[[(1R,2S)-2-methylcyclopropyl]amino]prop-2-enylidene]propanedioate (CID 164554721) is dimethyl 2-[(E)-3-[[(1R,2S)-2-methylcyclopropyl]amino]prop-2-enylidene]propanedioate.
What is the SMILES notation for dimethyl 2-[(E)-3-[[(1R,2S)-2-methylcyclopropyl]amino]prop-2-enylidene]propanedioate?
The canonical SMILES for dimethyl 2-[(E)-3-[[(1R,2S)-2-methylcyclopropyl]amino]prop-2-enylidene]propanedioate is COC(=O)C(=C/C=C/N[C@@H]1C[C@@H]1C)C(=O)OC.
What is the InChIKey of dimethyl 2-[(E)-3-[[(1R,2S)-2-methylcyclopropyl]amino]prop-2-enylidene]propanedioate?
The InChIKey is MPOWWPXXPDMORL-WUQHTFKHSA-N. The full InChI is InChI=1S/C12H17NO4/c1-8-7-10(8)13-6-4-5-9(11(14)16-2)12(15)17-3/h4-6,8,10,13H,7H2,1-3H3/b6-4+/t8-,10+/m0/s1.
What are the key properties of dimethyl 2-[(E)-3-[[(1R,2S)-2-methylcyclopropyl]amino]prop-2-enylidene]propanedioate?
dimethyl 2-[(E)-3-[[(1R,2S)-2-methylcyclopropyl]amino]prop-2-enylidene]propanedioate has a molecular weight of 239.27 g/mol, XLogP of 0.77, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[(E)-3-[[(1R,2S)-2-methylcyclopropyl]amino]prop-2-enylidene]propanedioate is sourced from PubChem (CID 164554721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).