C12H23F3N2O2 — CID 164555235
ethane;N-(2-methylpropyl)-3-(trifluoromethyl)morpholine-4-carboxamide (PubChem CID 164555235) has the molecular formula C12H23F3N2O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is ethane;N-(2-methylpropyl)-3-(trifluoromethyl)morpholine-4-carboxamide.
| Compound Name | ethane;N-(2-methylpropyl)-3-(trifluoromethyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 164555235 |
| Molecular Formula | C12H23F3N2O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | ethane;N-(2-methylpropyl)-3-(trifluoromethyl)morpholine-4-carboxamide |
| SMILES | CC.CC(C)CNC(=O)N1CCOCC1C(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O2.C2H6/c1-7(2)5-14-9(16)15-3-4-17-6-8(15)10(11,12)13;1-2/h7-8H,3-6H2,1-2H3,(H,14,16);1-2H3 |
| InChIKey | YBBNWOFZURJRHS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |