About N-ethyl-3,3-difluoro-1-methylcyclobutane-1-carboxamide;propane
N-ethyl-3,3-difluoro-1-methylcyclobutane-1-carboxamide;propane (PubChem CID 164555304) has the molecular formula C11H21F2NO
and a molecular weight of 221.29 g/mol. Its IUPAC name is N-ethyl-3,3-difluoro-1-methylcyclobutane-1-carboxamide;propane.
Molecular Properties
| Compound Name | N-ethyl-3,3-difluoro-1-methylcyclobutane-1-carboxamide;propane |
| PubChem CID | 164555304 |
| Molecular Formula | C11H21F2NO |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | N-ethyl-3,3-difluoro-1-methylcyclobutane-1-carboxamide;propane |
| SMILES | CCC.CCNC(=O)C1(C)CC(F)(F)C1 |
| InChI | InChI=1S/C8H13F2NO.C3H8/c1-3-11-6(12)7(2)4-8(9,10)5-7;1-3-2/h3-5H2,1-2H3,(H,11,12);3H2,1-2H3 |
| InChIKey | UDBABWVJWQSIQG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-3,3-difluoro-1-methylcyclobutane-1-carboxamide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3,3-difluoro-1-methylcyclobutane-1-carboxamide;propane?
The IUPAC name of N-ethyl-3,3-difluoro-1-methylcyclobutane-1-carboxamide;propane (CID 164555304) is N-ethyl-3,3-difluoro-1-methylcyclobutane-1-carboxamide;propane.
What is the SMILES notation for N-ethyl-3,3-difluoro-1-methylcyclobutane-1-carboxamide;propane?
The canonical SMILES for N-ethyl-3,3-difluoro-1-methylcyclobutane-1-carboxamide;propane is CCC.CCNC(=O)C1(C)CC(F)(F)C1.
What is the InChIKey of N-ethyl-3,3-difluoro-1-methylcyclobutane-1-carboxamide;propane?
The InChIKey is UDBABWVJWQSIQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2NO.C3H8/c1-3-11-6(12)7(2)4-8(9,10)5-7;1-3-2/h3-5H2,1-2H3,(H,11,12);3H2,1-2H3.
What are the key properties of N-ethyl-3,3-difluoro-1-methylcyclobutane-1-carboxamide;propane?
N-ethyl-3,3-difluoro-1-methylcyclobutane-1-carboxamide;propane has a molecular weight of 221.29 g/mol, XLogP of 2.97, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3,3-difluoro-1-methylcyclobutane-1-carboxamide;propane is sourced from PubChem (CID 164555304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).