About 2,2-difluoro-3,3-dimethyl-N-propylcyclopropane-1-carboxamide;ethane
2,2-difluoro-3,3-dimethyl-N-propylcyclopropane-1-carboxamide;ethane (PubChem CID 164555511) has the molecular formula C11H21F2NO
and a molecular weight of 221.29 g/mol. Its IUPAC name is 2,2-difluoro-3,3-dimethyl-N-propylcyclopropane-1-carboxamide;ethane.
Molecular Properties
| Compound Name | 2,2-difluoro-3,3-dimethyl-N-propylcyclopropane-1-carboxamide;ethane |
| PubChem CID | 164555511 |
| Molecular Formula | C11H21F2NO |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 2,2-difluoro-3,3-dimethyl-N-propylcyclopropane-1-carboxamide;ethane |
| SMILES | CC.CCCNC(=O)C1C(C)(C)C1(F)F |
| InChI | InChI=1S/C9H15F2NO.C2H6/c1-4-5-12-7(13)6-8(2,3)9(6,10)11;1-2/h6H,4-5H2,1-3H3,(H,12,13);1-2H3 |
| InChIKey | ZAWXBZVFWMCTIW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-difluoro-3,3-dimethyl-N-propylcyclopropane-1-carboxamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-3,3-dimethyl-N-propylcyclopropane-1-carboxamide;ethane?
The IUPAC name of 2,2-difluoro-3,3-dimethyl-N-propylcyclopropane-1-carboxamide;ethane (CID 164555511) is 2,2-difluoro-3,3-dimethyl-N-propylcyclopropane-1-carboxamide;ethane.
What is the SMILES notation for 2,2-difluoro-3,3-dimethyl-N-propylcyclopropane-1-carboxamide;ethane?
The canonical SMILES for 2,2-difluoro-3,3-dimethyl-N-propylcyclopropane-1-carboxamide;ethane is CC.CCCNC(=O)C1C(C)(C)C1(F)F.
What is the InChIKey of 2,2-difluoro-3,3-dimethyl-N-propylcyclopropane-1-carboxamide;ethane?
The InChIKey is ZAWXBZVFWMCTIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO.C2H6/c1-4-5-12-7(13)6-8(2,3)9(6,10)11;1-2/h6H,4-5H2,1-3H3,(H,12,13);1-2H3.
What are the key properties of 2,2-difluoro-3,3-dimethyl-N-propylcyclopropane-1-carboxamide;ethane?
2,2-difluoro-3,3-dimethyl-N-propylcyclopropane-1-carboxamide;ethane has a molecular weight of 221.29 g/mol, XLogP of 2.83, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-3,3-dimethyl-N-propylcyclopropane-1-carboxamide;ethane is sourced from PubChem (CID 164555511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).