About 1-(3,3-difluoroazetidin-1-yl)-3-methyl-4-sulfanylbutan-1-one
1-(3,3-difluoroazetidin-1-yl)-3-methyl-4-sulfanylbutan-1-one (PubChem CID 164555648) has the molecular formula C8H13F2NOS
and a molecular weight of 209.26 g/mol. Its IUPAC name is 1-(3,3-difluoroazetidin-1-yl)-3-methyl-4-sulfanylbutan-1-one.
Molecular Properties
| Compound Name | 1-(3,3-difluoroazetidin-1-yl)-3-methyl-4-sulfanylbutan-1-one |
| PubChem CID | 164555648 |
| Molecular Formula | C8H13F2NOS |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 1-(3,3-difluoroazetidin-1-yl)-3-methyl-4-sulfanylbutan-1-one |
| SMILES | CC(CS)CC(=O)N1CC(F)(F)C1 |
| InChI | InChI=1S/C8H13F2NOS/c1-6(3-13)2-7(12)11-4-8(9,10)5-11/h6,13H,2-5H2,1H3 |
| InChIKey | XFIZIMIUSRCMIF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-difluoroazetidin-1-yl)-3-methyl-4-sulfanylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-difluoroazetidin-1-yl)-3-methyl-4-sulfanylbutan-1-one?
The IUPAC name of 1-(3,3-difluoroazetidin-1-yl)-3-methyl-4-sulfanylbutan-1-one (CID 164555648) is 1-(3,3-difluoroazetidin-1-yl)-3-methyl-4-sulfanylbutan-1-one.
What is the SMILES notation for 1-(3,3-difluoroazetidin-1-yl)-3-methyl-4-sulfanylbutan-1-one?
The canonical SMILES for 1-(3,3-difluoroazetidin-1-yl)-3-methyl-4-sulfanylbutan-1-one is CC(CS)CC(=O)N1CC(F)(F)C1.
What is the InChIKey of 1-(3,3-difluoroazetidin-1-yl)-3-methyl-4-sulfanylbutan-1-one?
The InChIKey is XFIZIMIUSRCMIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2NOS/c1-6(3-13)2-7(12)11-4-8(9,10)5-11/h6,13H,2-5H2,1H3.
What are the key properties of 1-(3,3-difluoroazetidin-1-yl)-3-methyl-4-sulfanylbutan-1-one?
1-(3,3-difluoroazetidin-1-yl)-3-methyl-4-sulfanylbutan-1-one has a molecular weight of 209.26 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-difluoroazetidin-1-yl)-3-methyl-4-sulfanylbutan-1-one is sourced from PubChem (CID 164555648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).