C11H20F4N2O — CID 164556283
ethane;3,3,4,4-tetrafluoro-N-(2-methylpropyl)pyrrolidine-1-carboxamide (PubChem CID 164556283) has the molecular formula C11H20F4N2O and a molecular weight of 272.29 g/mol. Its IUPAC name is ethane;3,3,4,4-tetrafluoro-N-(2-methylpropyl)pyrrolidine-1-carboxamide.
| Compound Name | ethane;3,3,4,4-tetrafluoro-N-(2-methylpropyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 164556283 |
| Molecular Formula | C11H20F4N2O |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | ethane;3,3,4,4-tetrafluoro-N-(2-methylpropyl)pyrrolidine-1-carboxamide |
| SMILES | CC.CC(C)CNC(=O)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C9H14F4N2O.C2H6/c1-6(2)3-14-7(16)15-4-8(10,11)9(12,13)5-15;1-2/h6H,3-5H2,1-2H3,(H,14,16);1-2H3 |
| InChIKey | VWFXWOMTYSAYEB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|