About 6-(5,6-dimethoxy-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine
6-(5,6-dimethoxy-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine (PubChem CID 164556550) has the molecular formula C23H22N4O2
and a molecular weight of 386.46 g/mol. Its IUPAC name is 6-(5,6-dimethoxy-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine.
Molecular Properties
| Compound Name | 6-(5,6-dimethoxy-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine |
| PubChem CID | 164556550 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 6-(5,6-dimethoxy-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine |
| SMILES | COc1cc(-c2ccc3ncnc(NC(C)c4ccccc4)c3c2)cnc1OC |
| InChI | InChI=1S/C23H22N4O2/c1-15(16-7-5-4-6-8-16)27-22-19-11-17(9-10-20(19)25-14-26-22)18-12-21(28-2)23(29-3)24-13-18/h4-15H,1-3H3,(H,25,26,27) |
| InChIKey | ZLKQIOPKHPXAFO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(5,6-dimethoxy-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5,6-dimethoxy-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine?
The IUPAC name of 6-(5,6-dimethoxy-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine (CID 164556550) is 6-(5,6-dimethoxy-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine.
What is the SMILES notation for 6-(5,6-dimethoxy-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine?
The canonical SMILES for 6-(5,6-dimethoxy-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine is COc1cc(-c2ccc3ncnc(NC(C)c4ccccc4)c3c2)cnc1OC.
What is the InChIKey of 6-(5,6-dimethoxy-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine?
The InChIKey is ZLKQIOPKHPXAFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O2/c1-15(16-7-5-4-6-8-16)27-22-19-11-17(9-10-20(19)25-14-26-22)18-12-21(28-2)23(29-3)24-13-18/h4-15H,1-3H3,(H,25,26,27).
What are the key properties of 6-(5,6-dimethoxy-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine?
6-(5,6-dimethoxy-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine has a molecular weight of 386.46 g/mol, XLogP of 4.88, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5,6-dimethoxy-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine is sourced from PubChem (CID 164556550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).