C19H22N4O4S — CID 164556713
[2-(1,3-benzodioxol-5-yl)cyclopropyl]-[4-(4-methyl-2,3-dihydrothiadiazole-5-carbonyl)piperazin-1-yl]methanone (PubChem CID 164556713) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)cyclopropyl]-[4-(4-methyl-2,3-dihydrothiadiazole-5-carbonyl)piperazin-1-yl]methanone.
| Compound Name | [2-(1,3-benzodioxol-5-yl)cyclopropyl]-[4-(4-methyl-2,3-dihydrothiadiazole-5-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 164556713 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)cyclopropyl]-[4-(4-methyl-2,3-dihydrothiadiazole-5-carbonyl)piperazin-1-yl]methanone |
| SMILES | CC1=C(C(=O)N2CCN(C(=O)C3CC3c3ccc4c(c3)OCO4)CC2)SNN1 |
| InChI | InChI=1S/C19H22N4O4S/c1-11-17(28-21-20-11)19(25)23-6-4-22(5-7-23)18(24)14-9-13(14)12-2-3-15-16(8-12)27-10-26-15/h2-3,8,13-14,20-21H,4-7,9-10H2,1H3 |
| InChIKey | XOTQRPNJRPOTQB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|