C16H33NO6 — CID 164557272
3-methyl-N-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]butanamide;molecular hydrogen (PubChem CID 164557272) has the molecular formula C16H33NO6 and a molecular weight of 335.44 g/mol. Its IUPAC name is 3-methyl-N-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]butanamide;molecular hydrogen.
| Compound Name | 3-methyl-N-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]butanamide;molecular hydrogen |
|---|---|
| PubChem CID | 164557272 |
| Molecular Formula | C16H33NO6 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 3-methyl-N-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]butanamide;molecular hydrogen |
| SMILES | CC(=O)COCCOCCOCCOCCNC(=O)CC(C)C.[H][H] |
| InChI | InChI=1S/C16H31NO6.H2/c1-14(2)12-16(19)17-4-5-20-6-7-21-8-9-22-10-11-23-13-15(3)18;/h14H,4-13H2,1-3H3,(H,17,19);1H |
| InChIKey | KQDOBCMROXSIJX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|