C18H19NO4 — CID 164557361
dimethyl 3-(N,4-dimethylanilino)benzene-1,2-dicarboxylate (PubChem CID 164557361) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is dimethyl 3-(N,4-dimethylanilino)benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3-(N,4-dimethylanilino)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 164557361 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | dimethyl 3-(N,4-dimethylanilino)benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1cccc(N(C)c2ccc(C)cc2)c1C(=O)OC |
| InChI | InChI=1S/C18H19NO4/c1-12-8-10-13(11-9-12)19(2)15-7-5-6-14(17(20)22-3)16(15)18(21)23-4/h5-11H,1-4H3 |
| InChIKey | DRKGXFLRGGNBQP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |