About 3,6-dimethyl-4-(trifluoromethyl)pyridazine;ethane
3,6-dimethyl-4-(trifluoromethyl)pyridazine;ethane (PubChem CID 164557661) has the molecular formula C9H13F3N2
and a molecular weight of 206.21 g/mol. Its IUPAC name is 3,6-dimethyl-4-(trifluoromethyl)pyridazine;ethane.
Molecular Properties
| Compound Name | 3,6-dimethyl-4-(trifluoromethyl)pyridazine;ethane |
| PubChem CID | 164557661 |
| Molecular Formula | C9H13F3N2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 3,6-dimethyl-4-(trifluoromethyl)pyridazine;ethane |
| SMILES | CC.Cc1cc(C(F)(F)F)c(C)nn1 |
| InChI | InChI=1S/C7H7F3N2.C2H6/c1-4-3-6(7(8,9)10)5(2)12-11-4;1-2/h3H,1-2H3;1-2H3 |
| InChIKey | NJZIHKOCMGCKKT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dimethyl-4-(trifluoromethyl)pyridazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-4-(trifluoromethyl)pyridazine;ethane?
The IUPAC name of 3,6-dimethyl-4-(trifluoromethyl)pyridazine;ethane (CID 164557661) is 3,6-dimethyl-4-(trifluoromethyl)pyridazine;ethane.
What is the SMILES notation for 3,6-dimethyl-4-(trifluoromethyl)pyridazine;ethane?
The canonical SMILES for 3,6-dimethyl-4-(trifluoromethyl)pyridazine;ethane is CC.Cc1cc(C(F)(F)F)c(C)nn1.
What is the InChIKey of 3,6-dimethyl-4-(trifluoromethyl)pyridazine;ethane?
The InChIKey is NJZIHKOCMGCKKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3N2.C2H6/c1-4-3-6(7(8,9)10)5(2)12-11-4;1-2/h3H,1-2H3;1-2H3.
What are the key properties of 3,6-dimethyl-4-(trifluoromethyl)pyridazine;ethane?
3,6-dimethyl-4-(trifluoromethyl)pyridazine;ethane has a molecular weight of 206.21 g/mol, XLogP of 3.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-4-(trifluoromethyl)pyridazine;ethane is sourced from PubChem (CID 164557661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).