C25H34F3N5O — CID 164557761
2-[(2,2-dimethyloxan-4-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;6-[2-(trifluoromethyl)-3-pyridinyl]pyridazin-3-amine (PubChem CID 164557761) has the molecular formula C25H34F3N5O and a molecular weight of 477.58 g/mol. Its IUPAC name is 2-[(2,2-dimethyloxan-4-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;6-[2-(trifluoromethyl)-3-pyridinyl]pyridazin-3-amine.
| Compound Name | 2-[(2,2-dimethyloxan-4-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;6-[2-(trifluoromethyl)-3-pyridinyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 164557761 |
| Molecular Formula | C25H34F3N5O |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | 2-[(2,2-dimethyloxan-4-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;6-[2-(trifluoromethyl)-3-pyridinyl]pyridazin-3-amine |
| SMILES | CC1(C)CC(CN2CC3CCCC3C2)CCO1.Nc1ccc(-c2cccnc2C(F)(F)F)nn1 |
| InChI | InChI=1S/C15H27NO.C10H7F3N4/c1-15(2)8-12(6-7-17-15)9-16-10-13-4-3-5-14(13)11-16;11-10(12,13)9-6(2-1-5-15-9)7-3-4-8(14)17-16-7/h12-14H,3-11H2,1-2H3;1-5H,(H2,14,17) |
| InChIKey | NZFXJDNTODCVLT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |