About 1-[(E)-3,3-difluoro-2-methylbut-1-enyl]-N-(4-methylcyclohexyl)-6-methylidenepyridin-2-amine
1-[(E)-3,3-difluoro-2-methylbut-1-enyl]-N-(4-methylcyclohexyl)-6-methylidenepyridin-2-amine (PubChem CID 164558181) has the molecular formula C18H26F2N2
and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-[(E)-3,3-difluoro-2-methylbut-1-enyl]-N-(4-methylcyclohexyl)-6-methylidenepyridin-2-amine.
Molecular Properties
| Compound Name | 1-[(E)-3,3-difluoro-2-methylbut-1-enyl]-N-(4-methylcyclohexyl)-6-methylidenepyridin-2-amine |
| PubChem CID | 164558181 |
| Molecular Formula | C18H26F2N2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 1-[(E)-3,3-difluoro-2-methylbut-1-enyl]-N-(4-methylcyclohexyl)-6-methylidenepyridin-2-amine |
| SMILES | C=C1C=CC=C(NC2CCC(C)CC2)N1/C=C(\C)C(C)(F)F |
| InChI | InChI=1S/C18H26F2N2/c1-13-8-10-16(11-9-13)21-17-7-5-6-15(3)22(17)12-14(2)18(4,19)20/h5-7,12-13,16,21H,3,8-11H2,1-2,4H3/b14-12+ |
| InChIKey | YVMKGGIPYKEYGF-WYMLVPIESA-N |
| XLogP | 4.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(E)-3,3-difluoro-2-methylbut-1-enyl]-N-(4-methylcyclohexyl)-6-methylidenepyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-3,3-difluoro-2-methylbut-1-enyl]-N-(4-methylcyclohexyl)-6-methylidenepyridin-2-amine?
The IUPAC name of 1-[(E)-3,3-difluoro-2-methylbut-1-enyl]-N-(4-methylcyclohexyl)-6-methylidenepyridin-2-amine (CID 164558181) is 1-[(E)-3,3-difluoro-2-methylbut-1-enyl]-N-(4-methylcyclohexyl)-6-methylidenepyridin-2-amine.
What is the SMILES notation for 1-[(E)-3,3-difluoro-2-methylbut-1-enyl]-N-(4-methylcyclohexyl)-6-methylidenepyridin-2-amine?
The canonical SMILES for 1-[(E)-3,3-difluoro-2-methylbut-1-enyl]-N-(4-methylcyclohexyl)-6-methylidenepyridin-2-amine is C=C1C=CC=C(NC2CCC(C)CC2)N1/C=C(\C)C(C)(F)F.
What is the InChIKey of 1-[(E)-3,3-difluoro-2-methylbut-1-enyl]-N-(4-methylcyclohexyl)-6-methylidenepyridin-2-amine?
The InChIKey is YVMKGGIPYKEYGF-WYMLVPIESA-N. The full InChI is InChI=1S/C18H26F2N2/c1-13-8-10-16(11-9-13)21-17-7-5-6-15(3)22(17)12-14(2)18(4,19)20/h5-7,12-13,16,21H,3,8-11H2,1-2,4H3/b14-12+.
What are the key properties of 1-[(E)-3,3-difluoro-2-methylbut-1-enyl]-N-(4-methylcyclohexyl)-6-methylidenepyridin-2-amine?
1-[(E)-3,3-difluoro-2-methylbut-1-enyl]-N-(4-methylcyclohexyl)-6-methylidenepyridin-2-amine has a molecular weight of 308.42 g/mol, XLogP of 4.94, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-3,3-difluoro-2-methylbut-1-enyl]-N-(4-methylcyclohexyl)-6-methylidenepyridin-2-amine is sourced from PubChem (CID 164558181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).