C15H16F3N3 — CID 164558188
N-(4-methylcyclohex-3-en-1-yl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-5-amine (PubChem CID 164558188) has the molecular formula C15H16F3N3 and a molecular weight of 295.31 g/mol. Its IUPAC name is N-(4-methylcyclohex-3-en-1-yl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-5-amine.
| Compound Name | N-(4-methylcyclohex-3-en-1-yl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-5-amine |
|---|---|
| PubChem CID | 164558188 |
| Molecular Formula | C15H16F3N3 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-(4-methylcyclohex-3-en-1-yl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-5-amine |
| SMILES | CC1=CCC(Nc2cccc3nc(C(F)(F)F)cn23)CC1 |
| InChI | InChI=1S/C15H16F3N3/c1-10-5-7-11(8-6-10)19-13-3-2-4-14-20-12(9-21(13)14)15(16,17)18/h2-5,9,11,19H,6-8H2,1H3 |
| InChIKey | SNFYKKKZBODTMR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|